ChemNet > CAS > 423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
| product Name |
(1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol |
| CAS No |
423769-75-9 |
| Molecular Formula |
C8H10N2OS |
| Molecular Weight |
182.2428 |
| InChI |
InChI=1/C8H10N2OS/c1-5-7-3-6(4-11)12-8(7)10(2)9-5/h3,11H,4H2,1-2H3 |
| Molecular Structure |
![423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol](https://images-a.chemnet.com/suppliers/chembase/173/17339.gif)
|
| Density |
1.4g/cm3 |
| Melting point |
133℃ |
| Boiling point |
351.2°C at 760 mmHg |
| Refractive index |
1.69 |
| Flash point |
166.2°C |
| Vapour Pressur |
1.55E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
